3-Methylheptane
| 3-Methylheptane | |
|---|---|
| 3-Methylheptane[1] | |
| Identifiers | |
| CAS number | 589-81-1  , 6131-25-5 S
|
| PubChem | 11519, 12263096 R, 12263095 S |
| ChemSpider | 11035
|
| EC number | 209-660-6 |
| UN number | 1262 |
| Beilstein Reference | 1730777 |
| Jmol-3D images | Image 1 |
| |
| |
| Molecular formula | C8H18 |
| Molar mass | 114.23 g mol−1 |
| Thermochemistry | |
| Std enthalpy of formation ΔfH |
−253.6–−251.4 kJ mol−1 |
| Std enthalpy of combustion ΔcH |
−5469.5–−5466.9 kJ mol−1 |
| Standard molar entropy S |
362.6 J K−1 mol−1 |
| Specific heat capacity, C | 250.20 J K−1 mol−1 |
| Hazards | |
| GHS pictograms | |
| GHS signal word | DANGER |
| GHS hazard statements | H225, H304, H315, H336, H410 |
| GHS precautionary statements | P210, P261, P273, P301+310, P331 |
| EU Index | 601-009-00-8 |
| EU classification | F Xn N |
| R-phrases | R11, R38, R50/53, R65, R67 |
| S-phrases | (S2), S16, S29, S33 |
| Flash point | 7.2 °C |
| Explosive limits | 0.98–?% |
| Related compounds | |
| Related alkanes | |
| Related compounds | |
 (verify) (what is:  / ?)Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Its refractive index is 1.398 (20 °C, D).[citation needed]
References
- ↑ "3-METHYLHEPTANE - Compound Summary". PubChem Compound. USA: National Center for Biotechnology Information. 26 March 2005. Identification and Related Records. http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11519&loc=ec_rcs. Retrieved 8 March 2012.
External links
- Non-stereospecific oxidation of DL-3-methylheptane by aPseudomonas
- Physical and chemical properties table
| This article about a hydrocarbon is a stub. You can help Oilfield Wiki by expanding it. |
id:3-Metilheptana es:3-metilheptano fa:۳-متیلهپتان fr:3-méthylheptane
